|
| | L-ALANYL-L-TYROSINE Basic information |
| | L-ALANYL-L-TYROSINE Chemical Properties |
| Melting point | 238-240℃ (decomposition) | | Boiling point | 558.0±50.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | refractive index | 22 ° (C=2, 5mol/L HCl) | | storage temp. | -20°C | | solubility | almost transparency in 5mol/L HCl | | form | powder to crystal | | pka | 3.03±0.10(Predicted) | | color | White to Almost white | | Water Solubility | 17.99g/L at 20℃ | | InChI | InChI=1S/C12H16N2O4/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10-/m0/s1 | | InChIKey | ALZVPLKYDKJKQU-XVKPBYJWSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](C)N | | LogP | -0.31 at 25℃ | | CAS DataBase Reference | 3061-88-9(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924.29.7790 |
| | L-ALANYL-L-TYROSINE Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | L-Alanyl-L-tyrosine is used as a tyrosin source in intravenous nutrition of the rate.
| | Definition | ChEBI: A dipeptide composed of L-alanine and L-tyrosine joined by a peptide linkage. | | Flammability and Explosibility | Notclassified | | Biochem/physiol Actions | Alanyl dipeptides such as ala-leu, ala-lys, ala-gly, ala-pro, ala-tyr and ala-phe may be used in physicochemical studies or to evaluate dipeptide separation technologies. Alanyl dipeptides may also be used for studying cell uptake mechanisms, dipeptide metabolism or cell growth supplementation benefits. |
| | L-ALANYL-L-TYROSINE Preparation Products And Raw materials |
|