|
| | Triclabendazole Basic information |
| | Triclabendazole Chemical Properties |
| Melting point | 175-176°C | | Boiling point | 240.6°C (rough estimate) | | density | 1.3875 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly, Sonicated), Methanol (Slightly) | | pka | 7.91±0.10(Predicted) | | form | neat | | color | White to Beige | | Merck | 14,9652 | | BCS Class | 4/3 | | Stability: | Stability | | InChI | InChI=1S/C14H9Cl3N2OS/c1-21-14-18-9-5-8(16)12(6-10(9)19-14)20-11-4-2-3-7(15)13(11)17/h2-6H,1H3,(H,18,19) | | InChIKey | NQPDXQQQCQDHHW-UHFFFAOYSA-N | | SMILES | C1(SC)NC2=CC(Cl)=C(OC3=CC=CC(Cl)=C3Cl)C=C2N=1 | | CAS DataBase Reference | 68786-66-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | DD6747000 | | HS Code | 29339900 | | Toxicity | LD50 oral in rabbit: 206mg/kg |
| | Triclabendazole Usage And Synthesis |
| Description | Triclabendazole is a benzimidazole anthelmintic. It eliminates both immature and adult flukes in a sheep model of F. hepatica infection when administered at a dose of 10 mg/kg. Triclabendazole (5 μM) also protects against glucose- or α-synuclein-induced apoptosis in S. cerevisiae via inhibition of adenylyl cyclase in the Ras-adenylyl cyclase-protein kinase A (PKA) nutrient sensing pathway. | | Chemical Properties | Off-White Solid | | Uses | Triclabendazole is classified under the category of ‘Anthelmintic flukicide for veterinary use. | | Uses | An anthelmintic (fasciola). | | Definition | ChEBI: 6-chloro-5-(2,3-dichlorophenoxy)-2-(methylthio)-1H-benzimidazole is an aromatic ether. |
| | Triclabendazole Preparation Products And Raw materials |
|
