|  | |  |  | TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE Basic information | 
 | Product Name: | TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE |  | Synonyms: | benzene-1,3,5-tricarboxylic acid trimethyl ester;Trimethyl 1,3,5-benzenetricarboxylate 99%;1,3,5-Benzenetri(carboxylic acid methyl) ester;1,3,5-Benzenetricarboxylic acid trimethyl;1,3,5-Benzenetris(carboxylic acid methyl) ester;Trimethyl 1,3,5-benzenetricarboxylate,99%;5-benzene tricarboxylate;TriMethyl 1 |  | CAS: | 2672-58-4 |  | MF: | C12H12O6 |  | MW: | 252.22 |  | EINECS: | 220-215-5 |  | Product Categories: | Pyridines ,Halogenated Heterocycles;Aromatic Esters;C12  to  C63;Carbonyl  Compounds;Esters |  | Mol File: | 2672-58-4.mol |  |  | 
|  |  | TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE Chemical Properties | 
 | Melting point | 145-147 °C(lit.) |  | Boiling point | 230°C/0.5mmHg(lit.) |  | density | 1.241 |  | refractive index | 1.5230 (estimate) |  | storage temp. | Sealed in dry,Room Temperature |  | form | Crystalline Powder or Crystals |  | color | White to almost white |  | λmax | 282nm(CH3CN)(lit.) |  | BRN | 2219698 |  | InChI | InChI=1S/C12H12O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h4-6H,1-3H3 |  | InChIKey | RGCHNYAILFZUPL-UHFFFAOYSA-N |  | SMILES | C1(C(OC)=O)=CC(C(OC)=O)=CC(C(OC)=O)=C1 |  | CAS DataBase Reference | 2672-58-4(CAS DataBase Reference) | 
| Safety Statements | 24/25 |  | WGK Germany | 3 |  | HS Code | 29173990 | 
|  |  | TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE Usage And Synthesis | 
 | Chemical Properties | white to almost white crystalline powder or |  | Uses | Trimethyl 1,3,5-benzenetricarboxylate has been used to synthesize yttrium trimesates with open frameworks. | 
|  |  | TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE Preparation Products And Raw materials | 
 | Raw materials | 3-PYRROLIDIN-1-YLACRYLIC ACID METHYL ESTER-->TRIMETHYL 1,2,4-BENZENETRICARBOXYLATE-->1,2,3-Benzenetricarboxylic acid-->1,3,5-Benzenetricarboxylic acid chloride-->Sulfuric acid-->Methanol-->Trimesic acid-->Iodomethane-->acrylic acid methyl ester-->Methyl propiolate |  | Preparation Products | 1,3,5-Tris(bromomethyl)benzene-->Triethyl 1,3,5-benzenetricarboxylate-->METHYL 3,3-DIMETHOXYPROPIONATE | 
 |