|
| | Boc-O-tert-butyl-L-tyrosine Basic information |
| | Boc-O-tert-butyl-L-tyrosine Chemical Properties |
| Melting point | 113-118 °C | | alpha | -15 º (C=1% IN DMF) | | Boiling point | 484.0±40.0 °C(Predicted) | | density | 1.116±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.00±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | optical activity | [α]20/D 15.0±1.0°, c = 1% in DMF | | Water Solubility | Soluble in DMF. Insoluble in water. | | BRN | 4327336 | | InChI | InChI=1S/C18H27NO5/c1-17(2,3)23-13-9-7-12(8-10-13)11-14(15(20)21)19-16(22)24-18(4,5)6/h7-10,14H,11H2,1-6H3,(H,19,22)(H,20,21)/t14-/m0/s1 | | InChIKey | ZEQLLMOXFVKKCN-AWEZNQCLSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(OC(C)(C)C)C=C1)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 47375-34-8(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29242990 |
| | Boc-O-tert-butyl-L-tyrosine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Boc-O-tert-butyl-L-tyrosine is used as pharmaceutical intermediate. |
| | Boc-O-tert-butyl-L-tyrosine Preparation Products And Raw materials |
|