|
| | 7-Keto-dehydroepiandrosterone Basic information | | Regulation |
| | 7-Keto-dehydroepiandrosterone Chemical Properties |
| Melting point | 245-248 °C | | Boiling point | 477.1±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | solubility | DMF: 25 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 15 mg/ml; Ethanol: 10 mg/ml | | form | A crystalline solid | | pka | 14.67±0.60(Predicted) | | InChI | InChI=1/C19H26O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-14,17,20H,3-9H2,1-2H3/t12-,13-,14-,17-,18-,19-/s3 | | InChIKey | KPRGOTLNGIBVFL-YQJRJXGQNA-N | | SMILES | C[C@]12CC[C@H](O)CC1=CC(=O)[C@@]1([H])[C@]3([H])CCC(=O)[C@@]3(C)CC[C@]21[H] |&1:1,4,11,13,19,23,r| | | CAS DataBase Reference | 566-19-8(CAS DataBase Reference) |
| | 7-Keto-dehydroepiandrosterone Usage And Synthesis |
| Regulation |
The FDA has proposed that 7-Keto-DHEA be included among substances banned from use in compounded drugs.
| | Uses | 7-Keto Dehydro Epiandrosterone-d6 is the isotope labelled analog of 7-Keto Dehydro Epiandrosterone (K187700); a metabolite of Dehydroepiandrosterone (DHEA) (D229585) which is the major secretory steroidal product of the adrenal gland. | | Definition | ChEBI: 7-ketodehydroepiandrosterone is a 3beta-hydroxy-Delta(5)-steroid that is dehydroepiandrosterone carrying an additional oxo group at position 7. It has a role as a human blood serum metabolite, a nutraceutical and a prohormone. It is a 17-oxo steroid, a 3beta-hydroxy-Delta(5)-steroid, an androstanoid and a 7-oxo steroid. It is functionally related to a dehydroepiandrosterone. | | Side effects | 7-Keto-dehydroepiandrosterone might cause mild side effects such as nausea, dizziness, or low blood pressure in some people. | | Physiological effects | In the past ten years, a large number of studies have shown that 7-keto dehydroepiandrosterone has stronger physiological activity than DHEA, especially in anti-aging, enhancing immunity, improving memory, enhancing brain function, preventing Alzheimer’s and diabetes , It has a strong effect on reducing the risk of heart disease, losing weight, increasing bone density and muscle vitality. |
| | 7-Keto-dehydroepiandrosterone Preparation Products And Raw materials |
|
