|
| | 1,4-Dibenzyloxybenzene Basic information |
| | 1,4-Dibenzyloxybenzene Chemical Properties |
| Melting point | 128°C | | Boiling point | 441.7±25.0 °C(Predicted) | | density | 1.121±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | BRN | 2058196 | | InChI | InChI=1S/C20H18O2/c1-3-7-17(8-4-1)15-21-19-11-13-20(14-12-19)22-16-18-9-5-2-6-10-18/h1-14H,15-16H2 | | InChIKey | DYULYMCXVSRUPB-UHFFFAOYSA-N | | SMILES | C1(OCC2=CC=CC=C2)=CC=C(OCC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 621-91-0(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Dibenzyloxybenzene(621-91-0) |
| Safety Statements | 22-24/25 | | HS Code | 29093090 |
| Provider | Language |
|
ALFA
| English |
| | 1,4-Dibenzyloxybenzene Usage And Synthesis |
| Chemical Properties | Tan powder. Purity 90%
(min). Insoluble in water; soluble in acetone, benzene, and chlorobenzene. Combustible. | | Uses | 1,4-Dibenzyloxybenzene is a medium-strength rubber anti-aging agent, non-polluting, and does not change color under long-term sunlight exposure. Mainly used in the manufacture of sponge rubber products.
| | Preparation | 1,4-Bis(benzyloxy)benzene is synthesized by the reaction of hydroquinone and benzyl chloride. |
| | 1,4-Dibenzyloxybenzene Preparation Products And Raw materials |
|