|
| | 2-CHLORO-2-PROPEN-1-OL Basic information |
| Product Name: | 2-CHLORO-2-PROPEN-1-OL | | Synonyms: | 2-CHLORO-2-PROPEN-1-OL, TECH., 90%;2-Chloroallyl alcohol 98%;1-chloro-2-propenol;2-Chloro-1-propene-3-ol;2-Chloropropene-3-ol;2-Chloroprop-2-en-1-ol, 2-Chloro-3-hydroxyprop-1-ene;2-Chloro-2-propen-1-ol technical grade, 90%;2-Chloroallyl alcohol, technical grade | | CAS: | 5976-47-6 | | MF: | C3H5ClO | | MW: | 92.52 | | EINECS: | | | Product Categories: | | | Mol File: | 5976-47-6.mol |  |
| | 2-CHLORO-2-PROPEN-1-OL Chemical Properties |
| Boiling point | 133-134 °C (lit.) | | density | 1.162 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.459(lit.) | | Fp | 130 °F | | form | liquid | | pka | 11.45±0.10(Predicted) | | color | Clear, light yellow/brown | | InChI | InChI=1S/C3H5ClO/c1-3(4)2-5/h5H,1-2H2 | | InChIKey | OSCXYTRISGREIM-UHFFFAOYSA-N | | SMILES | C(O)C(Cl)=C | | EPA Substance Registry System | 2-Chloro-2-propen-1-ol (5976-47-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 10-20/21/22 | | Safety Statements | 16-26-27-36/37/39 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | RTECS | UD4725000 | | Hazard Note | Irritant | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 2905599890 |
| | 2-CHLORO-2-PROPEN-1-OL Usage And Synthesis |
| Uses | 2-Chloro-2-propen-1-ol (2-chloropropenol) may be employed as carbon supplement for the growth of Pseudomonas strains. It may be used in the preparation of 2-(4-octylphenyl)prop-2-en-1-ol. | | General Description | 2-Chloro-2-propen-1-ol is reported to undergo photodissociation at 193nm to generate CH2CCH2OH radical intermediate. 2-Chloro-2-propen-1-ol is formed as major product during base mediated reaction of 1,2,3-trichloropropane. 2-Chloro-2-propen-1-ol is reported to react with phosphorus trichloride to yield phosphorous esters, while with phosphory chloride it yields phosphoric ester. |
| | 2-CHLORO-2-PROPEN-1-OL Preparation Products And Raw materials |
|
