|
| | 3,5-Di-tert-butylbromobenzene Basic information |
| Product Name: | 3,5-Di-tert-butylbromobenzene | | Synonyms: | 1-Bromo-3,5-di-tert-butylbenzene;1-Bromo-3,5-di-tert-butylbenzene≥ 99%(GC);1-bromo-3,5-di-tert-butylbenzene, 3,5-di-tert-Bu-bromobenzene, 3,5-tert-butyl bromobenzene, bromo-3,5-di-t-butylbenzene, 1-bromo-3,5-di(tert-butyl)benzene, 1-bromo-3,5-di-tert-butyl benzene, 3,5-di-tert-butyl-1-bromobenzene;TIMTEC-BB SBB005901;3,5-DI-T-BUTYLBROMOBENZENE;3,5-Di-tert-butylbromobenzene;3,5-Di-tert-butylbromobenze;1-BROMO-3,5-DI-TERT-BUTYLBENZENE 99% | | CAS: | 22385-77-9 | | MF: | C14H21Br | | MW: | 269.22 | | EINECS: | 607-060-2 | | Product Categories: | Aryl;C13 to C37+;Halogenated Hydrocarbons | | Mol File: | 22385-77-9.mol |  |
| | 3,5-Di-tert-butylbromobenzene Chemical Properties |
| Melting point | 62-66 °C(lit.) | | Boiling point | 152-156 °C(Press: 26 Torr) | | density | 1.126±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 35μg/L at 25℃ | | BRN | 2091559 | | InChI | InChI=1S/C14H21Br/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3 | | InChIKey | BUOWTUULDKULFI-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | | LogP | 6.7 at 25℃ | | CAS DataBase Reference | 22385-77-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29039990 |
| | 3,5-Di-tert-butylbromobenzene Usage And Synthesis |
| Chemical Properties | White solid |
| | 3,5-Di-tert-butylbromobenzene Preparation Products And Raw materials |
|
