|
| | 2,6-DIBROMONAPHTHALENE Basic information |
| Product Name: | 2,6-DIBROMONAPHTHALENE | | Synonyms: | 2,6-DIBROMONAPHTHALENE;2,6-DIBROMONAPHTHALENE, 98.5%;2,6-Dibromonapthalene;Naphthalene, 2,6-dibroMo-;DibroMonaphthalene;2,6-dibroMophthalene;2,6-Dibromonaphthalene 99%;2,6-Dibromonaphthalene> | | CAS: | 13720-06-4 | | MF: | C10H6Br2 | | MW: | 285.96 | | EINECS: | 803-009-5 | | Product Categories: | Dibromonaphthalene | | Mol File: | 13720-06-4.mol |  |
| | 2,6-DIBROMONAPHTHALENE Chemical Properties |
| Melting point | 163-166°C | | Boiling point | 339.1±15.0 °C(Predicted) | | density | 1.834±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Gray to Brown | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H | | InChIKey | PJZDEYKZSZWFPX-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1Br | | CAS DataBase Reference | 13720-06-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2,6-DIBROMONAPHTHALENE Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | 2,6-Dibromonaphthalene is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. It reacts with hexylmagnesium bromide to form 2,6-Dihexyl-naphthalene. |
| | 2,6-DIBROMONAPHTHALENE Preparation Products And Raw materials |
|
