|
| | 5-Bromo-2-pyridinecarbonitrile Basic information |
| | 5-Bromo-2-pyridinecarbonitrile Chemical Properties |
| Melting point | 128-132 °C (lit.) | | Boiling point | 100-110 °C/3 mmHg (lit.) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in dichloromethane, ether, ethyl acetate and methanol | | pka | -2.68±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | BRN | 5498624 | | InChI | InChI=1S/C6H3BrN2/c7-5-1-2-6(3-8)9-4-5/h1-2,4H | | InChIKey | DMSHUVBQFSNBBL-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=C(Br)C=C1 | | CAS DataBase Reference | 97483-77-7(CAS DataBase Reference) |
| | 5-Bromo-2-pyridinecarbonitrile Usage And Synthesis |
| Chemical Properties | Light yellow Cryst | | Uses | 5-Bromo-2-pyridinecarbonitrile can be used in the synthesis of aza-terphenyl diamidine analogs, which exhibits potent antiprotozoal activity. It can also be used in the synthesis of pyridine-diketopyrrolopyrrole(PyDPP), a building block for preparing low band-gap copolymers for use as electron donor in polymer solar cells. |
| | 5-Bromo-2-pyridinecarbonitrile Preparation Products And Raw materials |
|