|
| | Sodium hexafluoroantimonate Basic information | | Uses |
| | Sodium hexafluoroantimonate Chemical Properties |
| density | 3.375 g/mL at 25 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: slightly soluble(lit.) | | form | Powder | | Specific Gravity | 3.375 | | color | White to off-white | | Water Solubility | SOLUBLE | | Sensitive | Air Sensitive | | Exposure limits | ACGIH: TWA 0.5 mg/m3
NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 | | InChI | InChI=1S/6FH.Na.Sb/h6*1H;;/q;;;;;;+1;+5/p-6 | | InChIKey | HKLMYZVMEYYVBS-UHFFFAOYSA-H | | SMILES | [Sb+5]([F-])([F-])([F-])([F-])([F-])[F-].[Na+] | | CAS DataBase Reference | 16925-25-0(CAS DataBase Reference) | | EPA Substance Registry System | Antimonate(1-), hexafluoro-, sodium, (OC-6-11)- (16925-25-0) |
| Hazard Codes | Xn,N,T,C | | Risk Statements | 20/22-51/53 | | Safety Statements | 61 | | RIDADR | UN 1549 6.1/PG 3 | | WGK Germany | 2 | | F | 1-10 | | Hazard Note | Corrosive/Toxic | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 28419085 |
| | Sodium hexafluoroantimonate Usage And Synthesis |
| Uses | Sodium Hexafluoroantimonate (nasbf6) is a deeply processed fine chemical of antimony. It is widely used as catalyst in organic synthesis and photochemical reaction and additive for high-grade glass; Additives for high-grade UV curing coatings and inks, pharmaceutical intermediates, material intermediates, etc.
Especially in organic synthesis, it is usually used as a substitute for organic fluoride and is used in many scientific fields from pharmaceutical chemistry to material science. This is because pentavalent antimony forms a very solid coordination bond with fluorine ion, which makes fluorine a very stable state. | | Chemical Properties | WHITE TO OFF-WHITE FINE CRYSTALLINE POWDER |
| | Sodium hexafluoroantimonate Preparation Products And Raw materials |
|
