|
| | 3,4-Difluoro-2-trifluoroMethyl-broMobenzene Basic information |
| Product Name: | 3,4-Difluoro-2-trifluoroMethyl-broMobenzene | | Synonyms: | 3,4-Difluoro-2-trifluoroMethyl-broMobenzene;1-bromo-3,4-difluoro-2-(trifluoromethyl)benzene;6-bromo-2,3-fifluorobenzotrifloride;6-Bromo-2,3-difluorobenzotrifluoride;Benzene, 1-bromo-3,4-difluoro-2-(trifluoromethyl)- | | CAS: | 1242339-23-6 | | MF: | C7H2BrF5 | | MW: | 260.99 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 1242339-23-6.mol |  |
| | 3,4-Difluoro-2-trifluoroMethyl-broMobenzene Chemical Properties |
| Boiling point | 168.4±35.0 °C(Predicted) | | density | 1.768±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H2BrF5/c8-3-1-2-4(9)6(10)5(3)7(11,12)13/h1-2H | | InChIKey | DKRBFARXIWUPMN-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(F)C(F)=C1C(F)(F)F |
| | 3,4-Difluoro-2-trifluoroMethyl-broMobenzene Usage And Synthesis |
| Uses | 3,4-Difluoro-2-trifluoromethyl-bromobenzene is a useful synthetic intermediate. |
| | 3,4-Difluoro-2-trifluoroMethyl-broMobenzene Preparation Products And Raw materials |
|
