|
| | N,N'-DIISOPROPYLTHIOUREA Basic information |
| | N,N'-DIISOPROPYLTHIOUREA Chemical Properties |
| Melting point | 143-145 °C (lit.) | | Boiling point | 110°C (rough estimate) | | density | 1.0247 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 13.93±0.70(Predicted) | | color | White | | InChI | InChI=1S/C7H16N2S/c1-5(2)8-7(10)9-6(3)4/h5-6H,1-4H3,(H2,8,9,10) | | InChIKey | KREOCUNMMFZOOS-UHFFFAOYSA-N | | SMILES | N(C(C)C)C(NC(C)C)=S | | CAS DataBase Reference | 2986-17-6(CAS DataBase Reference) | | NIST Chemistry Reference | Thiourea, n,n'-bis(1-methylethyl)-(2986-17-6) | | EPA Substance Registry System | Thiourea, N,N'-bis(1-methylethyl)- (2986-17-6) |
| | N,N'-DIISOPROPYLTHIOUREA Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | N,N''-Diisopropylthiourea is a reagent for the improved synthesis of cefathiamidine. Studies on the chemical nature of the thyroid inhibiting actions of compounds. Design and testing of antithyroid agents with decreased antioxidant activity. |
| | N,N'-DIISOPROPYLTHIOUREA Preparation Products And Raw materials |
|