|
| | 1,3,5-Trifluorobenzene Basic information |
| Product Name: | 1,3,5-Trifluorobenzene | | Synonyms: | Benzene, 1,3,5-trifluoro-;sym-Trifluorobenzene;1,3,5-TRIFLUOROBENZENE;1,3,5-Trifluorobenzene 98%;1,3,5-TRIFLUOTOBENZENE;1,3,5-Trifluorbenzol;1,3,5-trifluorobenzoic acid;Trifluorobenzene3 | | CAS: | 372-38-3 | | MF: | C6H3F3 | | MW: | 132.08 | | EINECS: | 206-751-2 | | Product Categories: | Aryl;C6;Aromatic Hydrocarbons (substituted) & Derivatives;Fluorobenzene;Miscellaneous;Halogenated Hydrocarbons;bc0001 | | Mol File: | 372-38-3.mol |  |
| | 1,3,5-Trifluorobenzene Chemical Properties |
| Melting point | -5.5 °C (lit.) | | Boiling point | 75-76 °C (lit.) | | density | 1.277 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.414(lit.) | | Fp | 19 °F | | storage temp. | Flammables area | | form | clear liquid | | Specific Gravity | 1.277 | | color | Colorless to Almost colorless | | Water Solubility | Insoluble in water. | | BRN | 1906457 | | InChI | InChI=1S/C6H3F3/c7-4-1-5(8)3-6(9)2-4/h1-3H | | InChIKey | JXUKFFRPLNTYIV-UHFFFAOYSA-N | | SMILES | C1(F)=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 372-38-3(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3,5-Trifluorobenzene(372-38-3) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36-7-33-29-7/9 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 2 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 |
| | 1,3,5-Trifluorobenzene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1,3,5-Trifluorobenzene was used in the synthesis of (-)-epicatechin and its 3-O-gallate. It is also used as an intermediate in organic chemical synthesis. | | Uses | 1,3,5-Trifluorobenzene was used in the synthesis of (?)-epicatechin and its 3-O-gallate. | | General Description | Rotational Raman spectra of 1,3,5-trifluorobenzene has been studied under high resolution using a single mode argon laser as the exciting source. Proton and fluorine magnetic resonance spectra of 1,3,5-trifluorobenzene in a nematic liquid crystal has been analyzed. |
| | 1,3,5-Trifluorobenzene Preparation Products And Raw materials |
| Raw materials | 1,2,4,5-Tetrafluorobenzene-->1,3,5-Trichloro-2,4,6-trifluorobenzene-->1,3-DICHLORO-2,4,6-TRIFLUOROBENZENE-->2,4,6-Trifluorochlorobenzene-->3,5-Difluoronitrobenzene-->3,5-Difluorochlorobenzene-->2,4,6-Trifluorophenylboronic acid-->Pentafluorobenzene-->1,2,3,4-Tetrafluorobenzene-->1,3,5-Trichlorobenzene-->3,5-Dichlorofluorobenzene | | Preparation Products | 3,5-Difluorophenylacetic acid-->2,4,6-TRIFLUOROBENZENESULFONYL CHLORIDE-->2,4,6-Trifluorobenzoic acid-->1-Bromo-2,4,6-trifluorobenzene-->2,4,6-TRIFLUOROIODOBENZENE-->1,3,5-Triphenylbenzene |
|
