|
| | 3,3'-Diamino-4,4'-dihydroxydiphenyl sulfone Basic information |
| | 3,3'-Diamino-4,4'-dihydroxydiphenyl sulfone Chemical Properties |
| Melting point | 231 °C | | Boiling point | 596.9±50.0 °C(Predicted) | | density | 1.564±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | slightly sol. in Methanol | | form | powder to crystal | | pka | 6.62±0.20(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C12H12N2O4S/c13-9-5-7(1-3-11(9)15)19(17,18)8-2-4-12(16)10(14)6-8/h1-6,15-16H,13-14H2 | | InChIKey | KECOIASOKMSRFT-UHFFFAOYSA-N | | SMILES | S(C1=CC=C(O)C(N)=C1)(C1=CC=C(O)C(N)=C1)(=O)=O | | CAS DataBase Reference | 7545-50-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | HazardClass | IRRITANT | | HS Code | 29222990 |
| | 3,3'-Diamino-4,4'-dihydroxydiphenyl sulfone Usage And Synthesis |
| | 3,3'-Diamino-4,4'-dihydroxydiphenyl sulfone Preparation Products And Raw materials |
|