|  | |  |  | ETHYL OXAMATE Basic information | 
|  |  | ETHYL OXAMATE Chemical Properties | 
 | Melting point | 112-115 °C |  | Boiling point | 218.88°C (rough estimate) |  | density | 1.3886 (rough estimate) |  | refractive index | 1.4540 (estimate) |  | storage temp. | Keep in dark place,Sealed in dry,Room Temperature |  | form | Crystalline Powder, Crystals, and/or Chunks |  | pka | 13.37±0.50(Predicted) |  | color | White |  | BRN | 506728 |  | InChI | InChI=1S/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |  | InChIKey | RZMZBHSKPLVQCP-UHFFFAOYSA-N |  | SMILES | C(OCC)(=O)C(N)=O |  | CAS DataBase Reference | 617-36-7(CAS DataBase Reference) | 
| Safety Statements | 24/25-22 |  | WGK Germany | 3 |  | HS Code | 29241990 | 
|  |  | ETHYL OXAMATE Usage And Synthesis | 
 | Chemical Properties | white crystalline powder |  | Uses | 2-Amino-2-oxo-acetic Acid Ethyl Ester is a reagent used to prepare methanotetrahydroisoquinolinecarboxylic acid. It can also be used in preparation of 1,2,4-Thiadiazole, a Cathepsin B inhibitor. | 
|  |  | ETHYL OXAMATE Preparation Products And Raw materials | 
 |