|
| | ETHYL OXAMATE Basic information |
| | ETHYL OXAMATE Chemical Properties |
| Melting point | 112-115 °C | | Boiling point | 218.88°C (rough estimate) | | density | 1.3886 (rough estimate) | | refractive index | 1.4540 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder, Crystals, and/or Chunks | | pka | 13.37±0.50(Predicted) | | color | White | | BRN | 506728 | | InChI | InChI=1S/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) | | InChIKey | RZMZBHSKPLVQCP-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(N)=O | | CAS DataBase Reference | 617-36-7(CAS DataBase Reference) |
| Safety Statements | 24/25-22 | | WGK Germany | 3 | | HS Code | 29241990 |
| | ETHYL OXAMATE Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2-Amino-2-oxo-acetic Acid Ethyl Ester is a reagent used to prepare methanotetrahydroisoquinolinecarboxylic acid. It can also be used in preparation of 1,2,4-Thiadiazole, a Cathepsin B inhibitor. |
| | ETHYL OXAMATE Preparation Products And Raw materials |
|