|
| | N6-Cbz-L-Lysine Basic information |
| | N6-Cbz-L-Lysine Chemical Properties |
| Melting point | 259 °C (dec.)(lit.) | | alpha | 14.4 º (c=1.6 in 1N HCl) | | Boiling point | 423.04°C (rough estimate) | | density | 1.1429 (rough estimate) | | refractive index | 16 ° (C=1.6, 2mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Base, Dilute Acid | | pka | 2.53±0.24(Predicted) | | form | Powder | | color | White to off-white | | optical activity | [α]20/D +15.5±1°, c = 1% in 1 M HCl | | BRN | 2222482 | | InChI | InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | CKGCFBNYQJDIGS-LBPRGKRZSA-N | | SMILES | C(O)(=O)[C@H](CCCCNC(OCC1=CC=CC=C1)=O)N | | CAS DataBase Reference | 1155-64-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | N6-Cbz-L-Lysine Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | Protected amino acid |
| | N6-Cbz-L-Lysine Preparation Products And Raw materials |
|