|
| | 2-(DI-T-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL Basic information |
| Product Name: | 2-(DI-T-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL | | Synonyms: | 2-(DI-TERT-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL;2-(DI-T-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL;2-Di-t-butylphosphino-2'-methylbiphenyl,99%;PHOSPHINE, BIS(1,1-DIMETHYLETHYL)(2''-METHYL[1,1''-BIPHENYL]-2-YL)-;tBuMePhos;2-(Di-tert-butylphosphino)-2'-methyl- biphenyl, 98+%;2-(Di-tert-butylphosphino)-2'-methylbiphenyl ,99%;Di-tert-butyl(2'-Methylbiphenyl-2-yl)phosphine | | CAS: | 255837-19-5 | | MF: | C21H29P | | MW: | 312.43 | | EINECS: | 607-748-2 | | Product Categories: | Achiral Phosphine;Aryl Phosphine | | Mol File: | 255837-19-5.mol |  |
| | 2-(DI-T-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL Chemical Properties |
| Melting point | 91-93 °C | | Boiling point | 408.0±24.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White | | Sensitive | Air Sensitive | | InChI | InChI=1S/C21H29P/c1-16-12-8-9-13-17(16)18-14-10-11-15-19(18)22(20(2,3)4)21(5,6)7/h8-15H,1-7H3 | | InChIKey | UJONYAVMBYXBJQ-UHFFFAOYSA-N | | SMILES | P(C(C)(C)C)(C(C)(C)C)C1=CC=CC=C1C1=CC=CC=C1C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 |
| Provider | Language |
|
ACROS
| English |
| | 2-(DI-T-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL Usage And Synthesis |
| Description | 2-(Di-t-butylphosphino)-2'-methylbiphenyl is a phosphine that has two functional groups, amide and aromatic hydrocarbon. The geometric isomers of this molecule are cis and trans. It can be used to diagnose reactions in a reaction vessel with mammalian cells. It also reacts with pyrazoles, triazoles and other molecules to form isomers at the 2 position of the biphenyl ring. | | Chemical Properties | White crystalline powder | | Uses | suzuki reaction | | Uses | A ligand for the palladium-catalyzed monoarylation of malonate esters, 1,3-diketones and isolated nitroalkanes. | | Application | 2-(Di-t-butylphosphino)-2'-methylbiphenyl has been shown to have cancer chemotherapeutic potential, as it inhibits the growth of cancer cells by binding to DNA and inhibiting its transcription. This compound also induces apoptosis in some cancer cells. |
| | 2-(DI-T-BUTYLPHOSPHINO)-2'-METHYLBIPHENYL Preparation Products And Raw materials |
|