|
| | 2-(Dicyclohexylphosphino)-2'-methylbiphenyl Basic information | | Reaction |
| | 2-(Dicyclohexylphosphino)-2'-methylbiphenyl Chemical Properties |
| Melting point | 107-111 °C | | Boiling point | 499.3±24.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | crystal | | color | white | | Water Solubility | insoluble | | Sensitive | Air Sensitive | | InChI | InChI=1S/C25H33P/c1-20-12-8-9-17-23(20)24-18-10-11-19-25(24)26(21-13-4-2-5-14-21)22-15-6-3-7-16-22/h8-12,17-19,21-22H,2-7,13-16H2,1H3 | | InChIKey | GPVWUKXZFDHGMZ-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1C1=CC=CC=C1C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29310099 |
| Provider | Language |
|
ACROS
| English |
| | 2-(Dicyclohexylphosphino)-2'-methylbiphenyl Usage And Synthesis |
| Reaction |
- Ligand used for the Pd-catalyzed formation of a-arylketones.
- Ligand used for the Pd-catalyzed amination reaction.
- Ligand used for the Pd-catalyzed hydrazone arylation.
- Ligand used for the Pd-catalyzed synthesis of 5,5-disubstituted butenolides.
- Ligand used for the Pd-catlyzed direct arylation of polyfluorinated arenes at room temperature.
| | Chemical Properties | White crystals or crystalline powder | | Uses | suzuki reaction | | Uses | 2-(Dicyclohexylphosphino)-2'-methylbiphenyl is a Ligand used for the Pd-catalyzed formation of a-arylketones
| | Uses | 2-(Dicyclohexylphosphino)-2''-methyl-biphenyl (CAS# 251320-86-2) can be used as a catalyst precursor to produce higher alcohols from syngas. It can also be used as a delta-lactone derivatives. |
| | 2-(Dicyclohexylphosphino)-2'-methylbiphenyl Preparation Products And Raw materials |
|
