|
| | Pramiracetam Basic information |
| | Pramiracetam Chemical Properties |
| Melting point | 47-48° | | Boiling point | bp0.15 162-164° | | density | 1.036±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | H2O: soluble10mg/mL, clear | | pka | 14.76±0.46(Predicted) | | form | powder | | color | white to beige | | Merck | 14,7706 | | InChI | InChI=1S/C14H27N3O2/c1-11(2)17(12(3)4)9-7-15-13(18)10-16-8-5-6-14(16)19/h11-12H,5-10H2,1-4H3,(H,15,18) | | InChIKey | ZULJGOSFKWFVRX-UHFFFAOYSA-N | | SMILES | N1(CC(NCCN(C(C)C)C(C)C)=O)CCCC1=O | | CAS DataBase Reference | 68497-62-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | UV6264081 | | HS Code | 2933.79.8500 |
| | Pramiracetam Usage And Synthesis |
| Description | Pramiracetam as a pyrrolidones cerebral metabolism improving drug,is a kind of CNS drugs that can help improve memory, anti-forgetful , it is developed by the United States Parke-Davis pharmaceutical companies, with a strong improvement in brain function, enhancing memory, the ability to promote brain alertness, and clinical trials have proved that its activity is 6-13 times of piracetam, 3-4 times of oxiracetam, 1.25 times of aniracetam, and it is toxicity low and well tolerated, it can be used for long-term medication to improve symptoms, and delay Alzheimer-type dementia.
Clinically relevant for elderly people attention and memory disorders, benign forgetfulness of aging, senile dementia (Alzheimer's disease) prevention, enhancing memory. Pramiracetam also applies to dilate blood vessels bodybuilding health products additives. | | Chemical Properties | white crystals | | Uses | Pramiracetam is an inhibitor of PREP and anti-migraine agent. It is a more potent nootropic drug derived from piracetam. Pramiracetam reportedly improved cognitive deficits associated with traumatic brain injuries. It was also effective in the treatment of cognitive disorders of cerebrovascular and traumatic origins. | | Definition | ChEBI: Pramiracetam is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid. | | Brand name | Remen (ParkeDavis). |
| | Pramiracetam Preparation Products And Raw materials |
|
