|
| | Himic anhydride Basic information |
| | Himic anhydride Chemical Properties |
| Melting point | 165-167 °C(lit.) | | Boiling point | 251.61°C (rough estimate) | | density | 1.2132 (rough estimate) | | refractive index | 1.5260 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | diethyl ether: soluble0.1g/10 mL, clear, colorless | | form | powder to crystal | | Specific Gravity | 1.250 (20/4℃) | | color | White to Almost white | | Merck | 14,1796 | | BRN | 150228 | | InChI | InChI=1S/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2 | | InChIKey | KNDQHSIWLOJIGP-UHFFFAOYSA-N | | SMILES | C1(=O)C2C(C3CC2C=C3)C(=O)O1 | | LogP | -0.040 (est) | | CAS DataBase Reference | 826-62-0(CAS DataBase Reference) | | EPA Substance Registry System | 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro- (826-62-0) |
| Hazard Codes | Xn | | Risk Statements | 41-42/43 | | Safety Statements | 22-24-26-37/39 | | RIDADR | UN 1325 | | WGK Germany | 3 | | RTECS | DT5600000 | | F | 21 | | HS Code | 38220090 | | Toxicity | skn-rbt 500 mg/24H MLD 28ZPAK -,140,72 |
| | Himic anhydride Usage And Synthesis |
| Chemical Properties | white solid | | Reactions | Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride reacts with methyl aminomethyllambertianate to give amide of bicyclo[2.2.1]heptan-1,2-dicarbocylic acid with a labdanoid substituent. | | Safety Profile | Mild skin and severe eye irritant.When heated to decomposition it emits acrid smoke andirritating fumes. |
| | Himic anhydride Preparation Products And Raw materials |
|
