|
| | 4-Hydroxybenzamide Basic information |
| | 4-Hydroxybenzamide Chemical Properties |
| Melting point | 161-162 °C (lit.) | | Boiling point | 345.3±25.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 8.60±0.13(Predicted) | | color | White to Light yellow to Dark green | | BRN | 1906921 | | InChI | InChI=1S/C7H7NO2/c8-7(10)5-1-3-6(9)4-2-5/h1-4,9H,(H2,8,10) | | InChIKey | QXSAKPUBHTZHKW-UHFFFAOYSA-N | | SMILES | C(N)(=O)C1=CC=C(O)C=C1 | | CAS DataBase Reference | 619-57-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | 4-Hydroxybenzamide Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | 4-Hydroxybenzamide is a secondary metabolite from marine sponge Phakellia fusca. | | Uses | 4-Hydroxybenzamide was used in the synthesis of balanol, a potent protein kinase C (PKC) inhibitor. | | Synthesis Reference(s) | Tetrahedron Letters, 19, p. 5183, 1978 DOI: 10.1016/S0040-4039(01)85844-5 | | General Description | The standard molar enthalpy of formation of 4-hydroxybenzamide was studied by micro- or macrocombustion calorimetry. |
| | 4-Hydroxybenzamide Preparation Products And Raw materials |
|
