|
| | TRUXENE Basic information |
| Product Name: | TRUXENE | | Synonyms: | 5H-Diindeno(1,2-a:1',2'-c)fluorene, 10,15-dihydro-;5H-Tribenzo[a,f,k]trindene, 10,15-dihydro-;alpha-Truxene;Benzene, tribenzylene-;Truxen;TRUXENE;10,15-DIHYDRO-5H-DIINDENO(1,2-A-1',2'-C)FLUORENE;10,15-dihydro-5H-tribenzo[a,f,k]triindene | | CAS: | 548-35-6 | | MF: | C27H18 | | MW: | 342.43 | | EINECS: | 208-944-7 | | Product Categories: | | | Mol File: | 548-35-6.mol |  |
| | TRUXENE Chemical Properties |
| Melting point | 370°C(lit.) | | Boiling point | 577.4±45.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C27H18/c1-4-10-19-16(7-1)13-22-25(19)23-14-17-8-3-6-12-21(17)27(23)24-15-18-9-2-5-11-20(18)26(22)24/h1-12H,13-15H2 | | InChIKey | YGPLLMPPZRUGTJ-UHFFFAOYSA-N | | SMILES | C12=CC=CC=C1CC1=C2C2=C(C3=CC=CC=C3C2)C2=C1C1=CC=CC=C1C2 |
| Safety Statements | 24/25 | | HS Code | 29029090 |
| | TRUXENE Usage And Synthesis |
| Chemical Properties | Light yellow to yellow solid |
| | TRUXENE Preparation Products And Raw materials |
|
