|
| | BOC-1,4-TRANS-ACHC-OH Basic information |
| | BOC-1,4-TRANS-ACHC-OH Chemical Properties |
| Melting point | 181.0 to 185.0 °C | | Boiling point | 396.7±31.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol (Slightly) | | form | Powder | | pka | 4.76±0.10(Predicted) | | color | White | | BRN | 7641071 | | InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-8(5-7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9- | | InChIKey | KXMRDHPZQHAXML-KYZUINATSA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@@H](NC(OC(C)(C)C)=O)CC1 | | CAS DataBase Reference | 53292-89-0(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | BOC-1,4-TRANS-ACHC-OH Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Boc-trans-4-aminocyclohexanecarboxylic acid is a reagent to synthesize N-myristoyltransferase and CD38 inhibitors. |
| | BOC-1,4-TRANS-ACHC-OH Preparation Products And Raw materials |
|