|
| | 5-Fluorocytidine Basic information |
| | 5-Fluorocytidine Chemical Properties |
| Melting point | 196-200 °C (lit.) | | alpha | 55 º (c=1, MeOH) | | Boiling point | 511.4±60.0 °C(Predicted) | | density | 1.98±0.1 g/cm3(Predicted) | | refractive index | 55 ° (C=1, MeOH) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | pka | 13.48±0.70(Predicted) | | color | White to Off-White | | optical activity | [α]20/D +55°, c = 1% in methanol | | InChI | InChI=1S/C9H12FN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1 | | InChIKey | STRZQWQNZQMHQR-UAKXSSHOSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=C(F)C(N)=NC2=O)[C@H](O)[C@@H]1O | | CAS DataBase Reference | 2341-22-2(CAS DataBase Reference) |
| | 5-Fluorocytidine Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | 5-Fluoropyrimidine nucleotides as probes of RNA structure using 19F-NMR spectroscopy. | | Definition | ChEBI: 5-fluorocytidine is an organofluorine compound and a member of cytidines. |
| | 5-Fluorocytidine Preparation Products And Raw materials |
|