|
| | N-ACETYL-ALPHA-D-GLUCOSAMINE Basic information | | Uses |
| Product Name: | N-ACETYL-ALPHA-D-GLUCOSAMINE | | Synonyms: | 2-ACETAMIDO-2-DEOXY-A-D-GLUCOPYRANOSE;2-ACETAMIDO-2-DEOXY-ALPHA-D-GLUCOPYRANOSE;2-ACETAMIDO-2-DEOXY-ALPHA-D-GLUCOSE;2-ACETOAMIDO-2-DEOXY-ALPHA-D-GLUCOPYRANOSE;2-ACETAMINO-2-DEOXY-A-D-GLUCOPYRANOSE;a-D-Glucopyranose, 2-(acetylaMino)-2-deoxy-;alpha-N-Acetyl-D-glucosamine, N-[(2S,3R,4R,5S,6R)-6-(Hydroxymethyl)-2,4,5-trihydroxytetrahydro-2H-pyran-3-yl]acetamide, 2-(Acetylamino)-2-deoxy-alpha-D-glucopyranose;Acetyl-D-glucosaMine research grade | | CAS: | 10036-64-3 | | MF: | C8H15NO6 | | MW: | 221.21 | | EINECS: | 233-115-1 | | Product Categories: | | | Mol File: | 10036-64-3.mol |  |
| | N-ACETYL-ALPHA-D-GLUCOSAMINE Chemical Properties |
| Melting point | 211 °C | | Boiling point | 595.4±50.0 °C(Predicted) | | density | 1.50 | | storage temp. | Refrigerator (+4°C) | | form | powder | | pka | 12.04±0.70(Predicted) | | color | White | | InChI | InChI=1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8+/s3 | | InChIKey | OVRNDRQMDRJTHS-UWNFICOENA-N | | SMILES | N([C@H]1[C@H](O[C@H](CO)[C@@H](O)[C@@H]1O)O)C(=O)C |&1:1,2,4,7,9,r| | | LogP | -2.314 (est) | | CAS DataBase Reference | 10036-64-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | HS Code | 29329900 |
| Provider | Language |
|
ACROS
| English |
| | N-ACETYL-ALPHA-D-GLUCOSAMINE Usage And Synthesis |
| Uses | N-Acetyl-a-D-glucosamine is a useful research chemical compound. | | Description | N-Acetyl-α-D-glucosamine is a low energy, vivo animal, chemical biology, expressed, oligosaccharides, acceptor. It is an acetylated amino sugar that can be found in the cell membrane surface of bacteria and is also a protein target for acetylation. | | Chemical Properties | White to off-white powder | | Uses | N-Acetyl-α-D-glucosamine has been shown to be involved in protein synthesis and growth factor activity. It has been used as a substrate for the production of monoclonal antibodies and has been shown to have stereoselective effects on the antibody response. | | Definition | ChEBI: An N-acetyl-D-glucosamine that has alpha-configuration at the anomeric centre. |
| | N-ACETYL-ALPHA-D-GLUCOSAMINE Preparation Products And Raw materials |
|