|
| | 1-beta-D-Arabinofuranosyluracil Basic information |
| | 1-beta-D-Arabinofuranosyluracil Chemical Properties |
| Melting point | 220-222°C | | storage temp. | -20°C | | solubility | Methanol (Slightly), Water (Slightly) | | pka | pK1:9.30 (25°C) | | density | 1.674±0.06 g/cm3(Predicted) | | form | Powder | | color | White to Off-white | | BRN | 28749 | | InChI | InChI=1/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7+,8-/s3 | | InChIKey | DRTQHJPVMGBUCF-YEZNIHIWNA-N | | SMILES | O[C@H]1[C@@H]([C@@H](CO)O[C@H]1N1C=CC(=O)NC1=O)O |&1:1,2,3,7,r| | | CAS DataBase Reference | 3083-77-0(CAS DataBase Reference) |
| | 1-beta-D-Arabinofuranosyluracil Usage And Synthesis |
| Description | 1-β-D-Arabinofuranosyluracil (ara-U) is an inactive metabolite of cytarabine . Ara-U is formed when cytarabine undergoes deamination by cytidine deaminase. | | Chemical Properties | White to Off-White Solid | | Uses | Antiviral agent.1-β-D-Arabinofuranosyluracil is used for the treatment of severe acute respiratory syndrome (SARS).
| | Definition | ChEBI: A natural product found in Lepisorus contortus. |
| | 1-beta-D-Arabinofuranosyluracil Preparation Products And Raw materials |
| Raw materials | 6H-Furo[2',3':4,5]oxazolo[3,2-a]pyrimidin-6-one, 2,3,3a,9a-tetrahydro-3-hydroxy-2-(hydroxymethyl)-, (2R,3R,3aR,9aR)--->2,2'-Cyclouridine-->Gemcitabine-->Cytarabine-->Uridine | | Preparation Products | Vidarabine-->THYMINE-BETA-D-ARABINOFURANOSIDE-->Cytarabine Impurity 12 |
|