|
| | 4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Basic information |
| Product Name: | 4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one | | Synonyms: | 4-amino-1-[(2r,3r,4r,5r)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;4-AMINO-1-((2R,3R,4R,5R)-3-FLUORO-4-HYDROXY-5-HYDROXYMETHYL-TETRAHYDRO-FURAN-2-YL)-1H-PYRIMIDIN-2-ONE;2'-FLUORO-D-CYTIDINE;2'-DEOXY-2'-FLUOROCYTIDINE;2'-FC;2'-FLUORO-2'-DEOXYCYTIDINE;2'-FdC;1-(2-Deoxy-2-fluoro-β-D-arabinofuranosyl)cytosine | | CAS: | 10212-20-1 | | MF: | C9H12FN3O4 | | MW: | 245.21 | | EINECS: | 1806241-263-5 | | Product Categories: | Biochemistry;Nucleosides and their analogs;Nucleosides, Nucleotides & Related Reagents;10212-20-1;Nucleosides | | Mol File: | 10212-20-1.mol | ![4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Structure](CAS/GIF/10212-20-1.gif) |
| | 4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical Properties |
| Melting point | 167 °C | | Boiling point | 500.1±60.0 °C(Predicted) | | density | 1.82±0.1 g/cm3(Predicted) | | refractive index | 80 ° (C=1, MeOH) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in DMSO, Methanol. | | pka | 12.84±0.70(Predicted) | | form | Powder | | color | White to Off-white | | Water Solubility | Water: 5 mg/mL (20.39 mM; ultrasonic and warming and heat to 60°C) | | InChI | InChI=1S/C9H12FN3O4/c10-6-7(15)4(3-14)17-8(6)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6-,7-,8-/m1/s1 | | InChIKey | NVZFZMCNALTPBY-XVFCMESISA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@H](F)[C@@H]1O | | CAS DataBase Reference | 10212-20-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 29389090 |
| | 4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2'-Deoxy-2'-fluorocytidine is a potent inhibitor of the subgenomic hepatitis C virus replicon in Huh-7 cells. 2'-Deoxy-2'-fluorocytidine has been shown to inhibit Borna Disease virus replication and s
pread. | | Uses | 2'-Fluoro-2'-deoxycytidine is a potent inhibitor of the subgenomic hepatitis C virus replicon in Huh-7 cells. 2'-Fluoro-2'-deoxycytidine has been shown to inhibit Borna Disease virus replication and spread. |
| | 4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Preparation Products And Raw materials |
|