|
| | 3-METHYL-1,2,4-TRIAZOLE-5-THIONE Basic information |
| Product Name: | 3-METHYL-1,2,4-TRIAZOLE-5-THIONE | | Synonyms: | 3-Mercapto-5-methyl-1,2,4-triazole;4-triazole-3-thione,1,2-dihydro-5-methyl-3h-2;5-Methyl-1,2,4-triazole-3-thione;5-methyl-2,4-dihydro-3h-1,2,4-triazole-3-thione;3-METHYL-1,2,4-TRIAZOLE-5-THIONE;3-METHYL-1H-1,2,4-TRIAZOL-5-YLHYDROSULFIDE;3-METHYL-1H-1,2,4-TRIAZOLE-5-THIOL;1,2-Dihydro-5-methyl-3H-1,2,4-triazole-3-thione | | CAS: | 7271-44-5 | | MF: | C3H5N3S | | MW: | 115.16 | | EINECS: | | | Product Categories: | | | Mol File: | 7271-44-5.mol |  |
| | 3-METHYL-1,2,4-TRIAZOLE-5-THIONE Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C3H5N3S/c1-2-4-3(7)6-5-2/h1H3,(H2,4,5,6,7) | | InChIKey | OUZCWDMJTKYHCA-UHFFFAOYSA-N | | SMILES | C1(C)=NNC(S)=N1 |
| | 3-METHYL-1,2,4-TRIAZOLE-5-THIONE Usage And Synthesis |
| Uses | 3-Methyl-1H(4H)-1,2,4-triazole-5-thione can be used as a suitable ionophore for fabrication of a new gadolinium(III) ion selective potentiometric sensor. Also used as potential metallo-β-lactamase inhibitors. |
| | 3-METHYL-1,2,4-TRIAZOLE-5-THIONE Preparation Products And Raw materials |
|
