|
| | 2-Amino-5-fluoropyridine Basic information |
| | 2-Amino-5-fluoropyridine Chemical Properties |
| Melting point | 93-97 °C (lit.) | | Boiling point | 125 °C | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | 4.62±0.13(Predicted) | | form | Powder | | color | White to orange | | BRN | 385938 | | InChI | InChI=1S/C5H5FN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) | | InChIKey | YJTXQLYMECWULH-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(F)C=C1 | | CAS DataBase Reference | 21717-96-4(CAS DataBase Reference) |
| | 2-Amino-5-fluoropyridine Usage And Synthesis |
| Chemical Properties | Light yellow Cryst | | Uses | 2-Amino-5-fluoropyridine is used in chemical microarrays to identify ligands that binds pathogenic cells. Acts as a reagent in the preparation of heterocyclic compounds as integrase inhibiting antiviral agents. | | Definition | ChEBI: 2-Amino-5-fluoropyridine is a dihydropyridine. | | Synthesis | 2-Amino-5-fluoropyridine is an important intermediate for the synthesis of LBM415 which is the peptide deformylas inhibitor. Using 2-aminopyridine as raw material and via nitrification, amino acetylation, reduction of nitro, diazolization, Schiemann reaction and hydrolysis of acetyl. |
| | 2-Amino-5-fluoropyridine Preparation Products And Raw materials |
|