|
| | 1-Boc-3-piperidone Basic information |
| | 1-Boc-3-piperidone Chemical Properties |
| Melting point | 35-40 °C (lit.) | | Boiling point | 289.8±33.0 °C(Predicted) | | density | 1.099±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | -1.71±0.20(Predicted) | | form | Liquid | | color | Clear colorless | | Water Solubility | It is insoluble in water. | | BRN | 5936353 | | InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h4-7H2,1-3H3 | | InChIKey | RIFXIGDBUBXKEI-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCC(=O)C1 | | CAS DataBase Reference | 98977-36-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | KEEP COLD | | HS Code | 29339900 |
| | 1-Boc-3-piperidone Usage And Synthesis |
| Chemical Properties | White to yellow low melting solid | | Uses | 1-Boc-3-piperidone, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Synthesis | With 179g compound 3(1-BOC-3-piperidines alcohol) drop in the 2L reaction flask, drop into pimelinketone 1300g, aluminum isopropylate 88g, methylene dichloride 400ml is warming up to 80 ℃, insulation reaction 8h, reaction finishes to be cooled to room temperature, adds 10% sodium hydroxide 200ml, stirring at normal temperature 30min, filter, the filtrate normal pressure reclaims methylene dichloride, reclaim under reduced pressure pimelinketone again, reclaim finish after, add the 300ml dichloromethane extraction three times, it is dry concentrated to merge oil reservoir, gets 1-BOC-3-piperidone crude product. Refining: with 1-BOC-3-piperidone crude product is that 60pa, temperature are to distill under 104 ~ 105 ℃ the condition at pressure, gets 1-BOC-3-piperidone elaboration 163g, 92.9%. |
| | 1-Boc-3-piperidone Preparation Products And Raw materials |
|