|  | |  |  | TETRA-N-PENTYLAMMONIUM CHLORIDE Basic information | 
|  |  | TETRA-N-PENTYLAMMONIUM CHLORIDE Chemical Properties | 
 | Melting point | ~195 °C |  | vapor density | 11.5 (vs air) |  | storage temp. | Inert atmosphere,Room Temperature |  | Water Solubility | almost transparency in Water |  | form | powder to crystal |  | color | White to Almost white |  | BRN | 3573674 |  | Stability: | Stable. Incompatible with strong oxidizing agents. |  | InChI | InChI=1S/C20H44N.ClH/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 |  | InChIKey | SXAWRMKQZKPHNJ-UHFFFAOYSA-M |  | SMILES | [N+](CCCCC)(CCCCC)(CCCCC)CCCCC.[Cl-] |  | CAS DataBase Reference | 4965-17-7(CAS DataBase Reference) |  | EPA Substance Registry System | 1-Pentanaminium, N,N,N-tripentyl-, chloride (4965-17-7) | 
| Hazard Codes | C |  | Risk Statements | 34 |  | Safety Statements | 26-36/37/39-45 |  | RIDADR | UN 2928 6.1/PG 2 |  | WGK Germany | 3 |  | RTECS | RZ9275000 |  | F | 3 |  | HazardClass | 6.1(b) |  | PackingGroup | III |  | HS Code | 29239000 | 
|  |  | TETRA-N-PENTYLAMMONIUM CHLORIDE Usage And Synthesis | 
 | Chemical Properties | white crystals | 
|  |  | TETRA-N-PENTYLAMMONIUM CHLORIDE Preparation Products And Raw materials | 
 |