|  | |  |  | 9-Bromophenanthrene Basic information | 
|  |  | 9-Bromophenanthrene Chemical Properties | 
 | Melting point | 60-64 °C (lit.) |  | Boiling point | 180-190 °C/2 mmHg (lit.) |  | density | 1.4251 (rough estimate) |  | refractive index | 1.6404 (estimate) |  | Fp | >230 °F |  | storage temp. | Sealed in dry,Room Temperature |  | solubility | chloroform: 50 mg/mL, clear |  | form | Powder |  | color | Light yellow |  | BRN | 1869927 |  | InChI | InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |  | InChIKey | RSQXKVWKJVUZDG-UHFFFAOYSA-N |  | SMILES | C1=C2C(C3C(C(Br)=C2)=CC=CC=3)=CC=C1 |  | CAS DataBase Reference | 573-17-1(CAS DataBase Reference) |  | NIST Chemistry Reference | Phenanthrene, 9-bromo-(573-17-1) | 
|  |  | 9-Bromophenanthrene Usage And Synthesis | 
 | Chemical Properties | light yellow powder |  | Chemical Properties | Soluble in toluene, and chloroform (50 mg/ml) |  | Uses | 9-Bromophenanthrene is used as halogenated building block. Isotope labelled 9-Bromophenanthrene (B687200), a halogenated polycyclic aromatic hydrocarbon that has been seen to have a room temperature phosphorescence that can be induced by β-cyclodextrin (β-CD) in the presence of cyclohexane; however, trace Fe(III) causes a decrease of the RTP emission. |  | Preparation | 9-Bromophenanthrene (90-94%) is produced by adding bromine to a refluxing solution of phenanthrene in carbon tetrachloride. This is the starting-point of 9-substituted phenanthrenes, e.g, when heated with cuprous cyanide at 260℃, 9-bromophenanthrene forms the corresponding cyano-compound; this may be hydrolysed to phenanthrene-9-carboxylic acid. Phenanthrene undergoes the Friedel-Crafts reaction mainly in the 3-, and to a small extent, in the 2-position. It is chloromethylated in the 9-position. When nitrated, phenanthrene gives a mixture of three mononitro-derivatives, the 3-isomer predominating. Sulphonation of phenanthrene gives a mixture of 1-, 2-, 3- and 9-phenanthrenesulphonic acids, and the ratio of these isomers depends on the temperature. | 
|  |  | 9-Bromophenanthrene Preparation Products And Raw materials | 
 |