|
| Product Name: | 4-BroMo-9,9-diphenyl-9H-fluorene | | Synonyms: | 4-BroMo-9,9-diphenyl-9H-fluorene;4-BroMo-9,9-diphenyl-9H-fluorne;1-(1-BENZYL-1H-PYRAZOL-3-YL)METHANAMINE DIHYDROCHLORIDE;9H-Fluorene, 4-bromo-9,9-diphenyl-;4-BDPF;4-bromo-9,9-diphenylanthracene;4-Bromo-9,9-diphenylfluorene >;5-Bromo-9,9-diphenyl-9H-fluorene | | CAS: | 713125-22-5 | | MF: | C25H17Br | | MW: | 397.31 | | EINECS: | | | Product Categories: | | | Mol File: | 713125-22-5.mol |  |
| | 4-BroMo-9,9-diphenyl-9H-fluorene Chemical Properties |
| Melting point | 213.5-214.5℃ (ethanol ) | | Boiling point | 480.5±24.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C25H17Br/c26-23-17-9-16-22-24(23)20-14-7-8-15-21(20)25(22,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-17H | | InChIKey | PBWATBVKPGTOTB-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=CC=C2Br |
| | 4-BroMo-9,9-diphenyl-9H-fluorene Usage And Synthesis |
| Appearance | White to light yellow powder to crystal | | Physical Form | solid | | Uses | 4-Bromo-9,9-diphenylfluorene belongs to the group of cyclic compounds and it has a high thermal stability and can be used in devices with high temperatures. |
| | 4-BroMo-9,9-diphenyl-9H-fluorene Preparation Products And Raw materials |
|
