|
| | 4-(hidroximetil)-5-metil-1,3-dioxol-2-one Basic information |
| Product Name: | 4-(hidroximetil)-5-metil-1,3-dioxol-2-one | | Synonyms: | 4-(HydroxyMethyl)-5-Methyl-[1,3]dioxol-2-one;1,3-Dioxol-2-one, 4-(hydroxymethyl)-5-methyl-;4-(hidroximetil)-5-metil-1,3-dioxol-2-ona;4-(hydroxymethyl)-5-methyl-l,3-dioxol-2-one;4-(hidroxiMetil)-5-Metil-1,3-dioxol-2-one;DMDO-OH;4-Methyl-5-hydroxyMethyl-2-oxo-1,3-dioxol-4-ene;AZATMint-D | | CAS: | 91526-18-0 | | MF: | C5H6O4 | | MW: | 130.1 | | EINECS: | 1308068-626-2 | | Product Categories: | | | Mol File: | 91526-18-0.mol |  |
| | 4-(hidroximetil)-5-metil-1,3-dioxol-2-one Chemical Properties |
| Boiling point | 214℃ | | density | 1.367 | | Fp | 93℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | pka | 14.54±0.10(Predicted) | | color | Pale yellow | | InChI | InChI=1S/C5H6O4/c1-3-4(2-6)9-5(7)8-3/h6H,2H2,1H3 | | InChIKey | JEQSUJXHFAXJOW-UHFFFAOYSA-N | | SMILES | O1C(C)=C(CO)OC1=O |
| | 4-(hidroximetil)-5-metil-1,3-dioxol-2-one Usage And Synthesis |
| Description | 4-(Hydroxymethyl)-5-methyl-1,3-dioxol-2-one is a reagent used in organic synthesis, particularly for the introduction of the non-chiral (oxodioxolenyl)methyl carbamate group to active pharmaceutical ingredients (APIs) to afford the corresponding pro-drug. | | Uses | 4-(Hydroxymethyl)-5-methyl-1,3-dioxol-2-one is used in preparation method of key intermediate of olmesartan medoxomil. |
| | 4-(hidroximetil)-5-metil-1,3-dioxol-2-one Preparation Products And Raw materials |
|