|
| | (1R,2R)-1,2-CYCLOHEXANEDIMETHANOL Basic information |
| Product Name: | (1R,2R)-1,2-CYCLOHEXANEDIMETHANOL | | Synonyms: | Lurasidone INT 3;[(1R,2R)-2-(hydroxymethyl)cyclohexyl]methanol;(1R,2R)-1,2-CYCLOHEXANEDI;(1R,2R)-1,2-Cyclohexanedimethanol;(1R,2R)-cyclohexane-1,2-diyldimethanol;(1R,2R)-1,2-Bis(hydroxymethyl)cyclohexane;(1R,2R)-1,2-CYCLOHEXANEDIMETHANOL;1,2-CyclohexanediMethanol, (1R,2R)- | | CAS: | 65376-05-8 | | MF: | C8H16O2 | | MW: | 144.21 | | EINECS: | 692-053-7 | | Product Categories: | Miscellaneous Reagents | | Mol File: | 65376-05-8.mol |  |
| | (1R,2R)-1,2-CYCLOHEXANEDIMETHANOL Chemical Properties |
| Melting point | 63.0 to 67.0 °C | | Boiling point | 270℃ | | density | 1.004 | | Fp | 129℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.75±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C8H16O2/c9-5-7-3-1-2-4-8(7)6-10/h7-10H,1-6H2/t7-,8-/m0/s1 | | InChIKey | XDODWINGEHBYRT-YUMQZZPRSA-N | | SMILES | [C@@H]1(CO)CCCC[C@H]1CO |
| | (1R,2R)-1,2-CYCLOHEXANEDIMETHANOL Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | (1R,2R)-1,2-Cyclohexanedimethanol (cas# 65376-05-8) is a compound useful in organic synthesis. |
| | (1R,2R)-1,2-CYCLOHEXANEDIMETHANOL Preparation Products And Raw materials |
|
