|  | |  |  | 3,5-Dichloro-2-cyanopyridine Basic information | 
 | Product Name: | 3,5-Dichloro-2-cyanopyridine |  | Synonyms: | 3,5-dichloropicolinonitrile;2-PYRIDINECARBONITRILE, 3,5-DICHLORO-;2-CYANO-3,5-DICHLOROPYRIDINE;3,5-DICHLORO-2-CYANOPYRIDINE;3,5-Dichloropicolinitrile;3,5-Dichloropyridine-2-carbonitrile;Cyanodichloropyridine 235---;3,5-Dichloro-2-pyridinecarbonitrile |  | CAS: | 85331-33-5 |  | MF: | C6H2Cl2N2 |  | MW: | 173 |  | EINECS: | 674-558-4 |  | Product Categories: | Building Blocks;C6;Pyridines, Pyrimidines, Purines and Pteredines;Pyridine series;Chemical Synthesis;Heterocyclic Building Blocks;Pyridines;Pyridine;Pyridines derivates |  | Mol File: | 85331-33-5.mol |  |  | 
|  |  | 3,5-Dichloro-2-cyanopyridine Chemical Properties | 
 | Melting point | 101-103°C |  | Boiling point | 271.9±35.0 °C(Predicted) |  | density | 1.49±0.1 g/cm3(Predicted) |  | storage temp. | Sealed in dry,Room Temperature |  | pka | -4.61±0.10(Predicted) |  | form | powder to crystal |  | color | White to Light yellow |  | BRN | 4390101 |  | InChI | InChI=1S/C6H2Cl2N2/c7-4-1-5(8)6(2-9)10-3-4/h1,3H |  | InChIKey | ATUOLSDAAPMVJJ-UHFFFAOYSA-N |  | SMILES | C1(C#N)=NC=C(Cl)C=C1Cl |  | CAS DataBase Reference | 85331-33-5(CAS DataBase Reference) | 
| Provider | Language |  
| ALFA | English |  |  |  | 3,5-Dichloro-2-cyanopyridine Usage And Synthesis | 
 | Chemical Properties | Yellow to light brown crystalline powder | 
|  |  | 3,5-Dichloro-2-cyanopyridine Preparation Products And Raw materials | 
 |