|
| | FMOC-Arg(Pbf)-OH Basic information |
| Product Name: | FMOC-Arg(Pbf)-OH | | Synonyms: | na-fmoc-ng-(2,2,4,6,7-pentamethyl-*dihydrobenzofu;-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidamido}pentanoic acid;FMOC-N-OMEGA-(2,2,4,6,7-PENTAMETHYLDIHYDROBENZOFURAN-5-SULFONYL)-L-ARGININE;FMOC-NG-PBF-L-ARGININE;FMOC-ARG(PBF);FMOC-ARGININE(PBF)-OH;FMOC-ARG(PBF)-OH;FMOC-(2,2,4,6,7-PENTAMETHYLDIHYDROBENZOFURAN-5-SULFONYL)-L-ARGININE | | CAS: | 154445-77-9 | | MF: | C34H40N4O7S | | MW: | 648.77 | | EINECS: | 604-954-4 | | Product Categories: | Arginine [Arg, R];Fmoc-Amino Acids and Derivatives;Amino Acids;Fmoc-Amino acid series | | Mol File: | 154445-77-9.mol |  |
| | FMOC-Arg(Pbf)-OH Chemical Properties |
| Melting point | 132°C | | alpha | -5.5 º (c=1,DMF) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | Store at -15°C to -25°C. | | solubility | DMF (Sparingly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.83±0.21(Predicted) | | color | White to Off-White | | optical activity | [α]/D -5.5±1.0°, c = 1 in DMF | | BRN | 8302671 | | InChIKey | YUMOVWGGELTYES-LJAQVGFWSA-N | | SMILES | C(O)(=O)[C@H](CCCNC=NNS(C1=C(C)C(C)=C2OC(C)(C)CC2=C1C)(=O)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 154445-77-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | HS Code | 2935 90 90 | | HazardClass | IRRITANT |
| | FMOC-Arg(Pbf)-OH Usage And Synthesis |
| Chemical Properties | white powde | | Uses | Fmoc-Arg(Pbf)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | Uses | Fmoc-Arg(Pbf)-OH is a Fmoc-protected amino acid derivative that can be used to create arginine-containing peptides. The 2,2,4,6,7-pentamethyIdlhydrobenzofuran-5-sulfonyl group (Pbf) can be easily cleaved by trifluoroacetic acid (TFA). |
| | FMOC-Arg(Pbf)-OH Preparation Products And Raw materials |
|