|
| | 2-Chloro-3',4'-dihydroxyacetophenone Basic information |
| | 2-Chloro-3',4'-dihydroxyacetophenone Chemical Properties |
| Melting point | 174-176 °C(lit.) | | Boiling point | 418.7±35.0 °C(Predicted) | | density | 1.444±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO, methanol. | | form | neat | | pka | 7.59±0.20(Predicted) | | color | White to Pale Beige | | BRN | 2092660 | | InChI | InChI=1S/C8H7ClO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4H2 | | InChIKey | LWTJEJCZJFZKEL-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CCl | | CAS DataBase Reference | 99-40-1(CAS DataBase Reference) |
| | 2-Chloro-3',4'-dihydroxyacetophenone Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 2-Chloro-3',4'-dihydroxyacetophenone is used as a styptic adrenobazone, quasi adrenaline drug gasp spirit of intermediates. | | Definition | ChEBI: 2-chloro-3',4'-dihydroxyacetophenone is an alpha-chloroketone, a member of acetophenones and an aromatic ketone. |
| | 2-Chloro-3',4'-dihydroxyacetophenone Preparation Products And Raw materials |
|