|  | |  |  | 2-Chloro-3',4'-dihydroxyacetophenone Basic information | 
|  |  | 2-Chloro-3',4'-dihydroxyacetophenone Chemical Properties | 
 | Melting point | 174-176 °C(lit.) |  | Boiling point | 418.7±35.0 °C(Predicted) |  | density | 1.444±0.06 g/cm3(Predicted) |  | storage temp. | 2-8°C |  | solubility | Soluble in DMSO, methanol. |  | form | neat |  | pka | 7.59±0.20(Predicted) |  | color | White to Pale Beige |  | BRN | 2092660 |  | InChI | InChI=1S/C8H7ClO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4H2 |  | InChIKey | LWTJEJCZJFZKEL-UHFFFAOYSA-N |  | SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CCl |  | CAS DataBase Reference | 99-40-1(CAS DataBase Reference) | 
|  |  | 2-Chloro-3',4'-dihydroxyacetophenone Usage And Synthesis | 
 | Chemical Properties | Off-White Solid |  | Uses | 2-Chloro-3',4'-dihydroxyacetophenone is used as a styptic adrenobazone, quasi adrenaline drug gasp spirit of intermediates. |  | Definition | ChEBI: 2-chloro-3',4'-dihydroxyacetophenone is an alpha-chloroketone, a member of acetophenones and an aromatic ketone. | 
|  |  | 2-Chloro-3',4'-dihydroxyacetophenone Preparation Products And Raw materials | 
 |