|  | |  |  | Fmoc-Phe-OH Basic information | 
|  |  | Fmoc-Phe-OH Chemical Properties | 
 | Melting point | 180-187 °C(lit.) |  | alpha | -38 º (c=1,DMF) |  | Boiling point | 513.39°C (rough estimate) |  | density | 1.2379 (rough estimate) |  | refractive index | -39.5 ° (C=1, DMF) |  | storage temp. | 2-8°C |  | solubility | Chloroform (Slightly), DMF (Sparingly, Sonicated), DMSO (Slightly) |  | pka | 3.77±0.10(Predicted) |  | form | Powder |  | color | White |  | optical activity | [α]20/D 37°, c = 1 in DMF |  | BRN | 3597808 |  | InChI | InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m0/s1 |  | InChIKey | SJVFAHZPLIXNDH-QFIPXVFZSA-N |  | SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |  | CAS DataBase Reference | 35661-40-6(CAS DataBase Reference) | 
|  |  | Fmoc-Phe-OH Usage And Synthesis | 
 | Chemical Properties | white to light yellow crystal powde |  | Uses | (Fmoc-Phe-OH) L-Phenylalanine (P319415) derivative, used in the preparation of peptides and deltorphin derivatives. A potential inhibitor of IGF-I and IGF-Binding Protein-5 complex. |  | General Description | The product number for this product was previously 04-12-1030. 
 To obtain a certificate of analysis (CoA) of a lot that begins with the letter “A”, please select the option in the right hand menu “Request a COA for Lot#s starting with A”.
 | 
|  |  | Fmoc-Phe-OH Preparation Products And Raw materials | 
 |