|
| | (R)-1-Boc-3-Aminopiperidine Basic information |
| Product Name: | (R)-1-Boc-3-Aminopiperidine | | Synonyms: | tert-Butyl (3R)-3-aminopiperidine-1-carboxylate;(R)-3-Aminopiperidine, N1-BOC protected;(R)-1-t-Butyloxycarbonyl-3-aminopiperidine hydrochloride;(R)-1-Boc-3-piperidinamine, tert-Butyl (R)-3-amino-1-piperidinecarboxylate;(R)-3-Amino-1-N-Boc-Piperidine (R)-1-Boc-3-Aminopiperidine;1-TERT-BUTYLOXYCARBONYL-3-R-AMINOPIPERIDINE HYDROCHLORIDE;1-Piperidinecarboxylicacid,3-amino-,1,1-dimethylethylester,(3R)-(9CI);(R)-3-AMINO-N-BOC-PIPERIDINE | | CAS: | 188111-79-7 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | 628-472-9 | | Product Categories: | CHIRAL CHEMICALS;Piperidines;AMINOACID;pharmacetical;Piperidine;Piperidine Series | | Mol File: | 188111-79-7.mol |  |
| | (R)-1-Boc-3-Aminopiperidine Chemical Properties |
| alpha | 28.5 º (c=1, DMF) | | Boiling point | 277.3±33.0 °C(Predicted) | | density | 1.041±0.06 g/cm3(Predicted) | | refractive index | 1.4730 | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), DMF (Slightly), DMSO (Slightly) | | pka | 10.35±0.20(Predicted) | | form | Liquid | | color | Colorless to pale yellow | | optical activity | [α]/D -28.5±2°, c = 1 in DMF | | Water Solubility | Immiscible with water. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m1/s1 | | InChIKey | AKQXKEBCONUWCL-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](N)C1 | | CAS DataBase Reference | 188111-79-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN2735 | | WGK Germany | 3 | | F | 10-34 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29333990 |
| | (R)-1-Boc-3-Aminopiperidine Usage And Synthesis |
| Chemical Properties | Yellow liquid | | Uses | (R)-(-)-3-Amino-1-Boc-piperidine(tert-Butyl (R)-3-Aminopiperidine-1-carboxylate), is an heterocyclic building block used for the synthesis of more complex pharmaceutical compounds. It is also found to act as a γ-secretase modulators, and a potent structure for lowering Ab42 production in both in vitro and in vivo. | | Uses | (R)-3-Amino-1-Boc-piperidine can be used to prepare a benzoxazepine derivative named (R)-7-(3,5-dimethoxyphenyl)-N-(piperidin-3-yl)-4-propionyl-2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxamide, a potent CBP/P300 bromodomain inhibitor. | | General Description | (R)-3-Amino-1-Boc-piperidine can be used as a precursor for the preparation of dipeptidyl peptidase IV inhibitors like linagliptin, alogliptin, and other antidiabetic agents. |
| | (R)-1-Boc-3-Aminopiperidine Preparation Products And Raw materials |
|
