|
| | 3-Hydroxycyclobutanecarboxylic acid Basic information |
| Product Name: | 3-Hydroxycyclobutanecarboxylic acid | | Synonyms: | Cyclobutanecarboxylic acid, 3-hydroxy-, trans-;(1r,3r)-3-hydroxycyclobutane-1-carboxylic acid;trans-3-Hydroxycyclobutanecarboxylic acid;(1R,3R)-3-hydroxycyclobutanecarboxylic acid;rac-(1r,3r)-3-hydroxycyclobutane-1-carboxylic acid, trans;3-HYDROXYCYCLOBUTANECARBOXYLIC ACID | | CAS: | 1268521-85-2 | | MF: | C5H8O3 | | MW: | 116.12 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 1268521-85-2.mol |  |
| | 3-Hydroxycyclobutanecarboxylic acid Chemical Properties |
| storage temp. | 2-8°C | | InChI | InChI=1S/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8)/t3-,4- | | InChIKey | ZSHGVMYLGGANKU-JPYJGEKTSA-N | | SMILES | [C@@H]1(C(O)=O)C[C@@H](O)C1 |
| | 3-Hydroxycyclobutanecarboxylic acid Usage And Synthesis |
| Uses | 3-Hydroxycyclobutanecarboxylic acid is used for synthesis API and research. |
| | 3-Hydroxycyclobutanecarboxylic acid Preparation Products And Raw materials |
|