|
| | 1-METHYL-4-(6-AMINOPYRIDIN-3-YL)PIPERAZINE Basic information |
| Product Name: | 1-METHYL-4-(6-AMINOPYRIDIN-3-YL)PIPERAZINE | | Synonyms: | 1-METHYL-4-(6-AMINOPYRIDIN-3-YL)PIPERAZINE;5-(4-Methyl-piperazin-1-yl)-pyridin-2-ylamine;5-(4-Methylpiperazin-1-yl);2-PyridinaMine, 5-(4-Methyl-1-piperazinyl)-;2-Amino-5-(4-methyl-1-piperazinyl)pyridine;2-Amino-5-(N-methylpiperazin-1-yl)pyridine;-4-(6-aminopyridin-3-yL;5-(4-Methyl-1-piperazinyl)-2-pyridinamine | | CAS: | 571189-49-6 | | MF: | C10H16N4 | | MW: | 192.26 | | EINECS: | | | Product Categories: | | | Mol File: | 571189-49-6.mol |  |
| | 1-METHYL-4-(6-AMINOPYRIDIN-3-YL)PIPERAZINE Chemical Properties |
| Melting point | 148 °C | | Boiling point | 368.1±42.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Water (Slightly) | | pka | 7.41±0.42(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H16N4/c1-13-4-6-14(7-5-13)9-2-3-10(11)12-8-9/h2-3,8H,4-7H2,1H3,(H2,11,12) | | InChIKey | QDMPMBFLXOWHRY-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(N2CCN(C)CC2)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 2933399990 |
| | 1-METHYL-4-(6-AMINOPYRIDIN-3-YL)PIPERAZINE Usage And Synthesis |
| Chemical Properties | Light yellow to Brown powder to crystal. | | Uses | 5-(4-Methylpiperazin-1-yl)pyridin-2-amine can be used for chemical mechanical planarization for tungsten-containing substrates. |
| | 1-METHYL-4-(6-AMINOPYRIDIN-3-YL)PIPERAZINE Preparation Products And Raw materials |
|
