|
| | Hexanophenone Basic information |
| | Hexanophenone Chemical Properties |
| Melting point | 25-26 °C (lit.) | | Boiling point | 265 °C (lit.) | | density | 0.958 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5105(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid After Melting | | color | Clear light yellow | | BRN | 1908667 | | InChI | InChI=1S/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 | | InChIKey | MAHPVQDVMLWUAG-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCCCC | | LogP | 3.790 (est) | | CAS DataBase Reference | 942-92-7(CAS DataBase Reference) | | EPA Substance Registry System | Hexanophenone (942-92-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29143900 |
| | Hexanophenone Usage And Synthesis |
| Chemical Properties | clear light yellow liquid after melting | | Uses | Caprophenone is an inhibitor of carbonyl reductase activity in pig’s heart cytosol. A useful research chemical. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 44, p. 3585, 1979 DOI: 10.1021/jo01334a033
Synthetic Communications, 8, p. 59, 1978 DOI: 10.1080/00397917808062184
Tetrahedron Letters, 24, p. 3677, 1983 DOI: 10.1016/S0040-4039(00)88199-X |
| | Hexanophenone Preparation Products And Raw materials |
|
