|
| | 4,6-Dimethoxypyrimidine Basic information |
| Product Name: | 4,6-Dimethoxypyrimidine | | Synonyms: | 4,6-DIMETHOXYPYRIMIDINE;4,6-Dimethoxypyrimdine;4,6-dimethyloxypyrimidine;Pyrimidine, 4,6-dimethoxy- (6CI,7CI,8CI,9CI);4,6-Dimethoxypyrimidine>;Pyrimidine, 4,6-dimethoxy-;4,6-Dimethoxypyrimidine ISO 9001：2015 REACH | | CAS: | 5270-94-0 | | MF: | C6H8N2O2 | | MW: | 140.14 | | EINECS: | | | Product Categories: | PYRIMIDINE;APIs & Intermediate | | Mol File: | 5270-94-0.mol |  |
| | 4,6-Dimethoxypyrimidine Chemical Properties |
| Melting point | 33 °C | | Boiling point | 186 °C | | density | 1.131±0.06 g/cm3(Predicted) | | refractive index | 1.49 | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to lump to clear liquid | | pka | 1.48±0.17(Predicted) | | color | White or Colorless to Almost white or Almost colorless | | InChI | InChI=1S/C6H8N2O2/c1-9-5-3-6(10-2)8-4-7-5/h3-4H,1-2H3 | | InChIKey | FPSPPRZKBUVEJQ-UHFFFAOYSA-N | | SMILES | C1=NC(OC)=CC(OC)=N1 | | CAS DataBase Reference | 5270-94-0(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 2933599590 |
| | 4,6-Dimethoxypyrimidine Usage And Synthesis |
| Chemical Properties | Yellow liquid | | Uses | 4,6-dimethoxypyrimidine is a major active group that is commonly used as an intermediate in organic synthesis. |
| | 4,6-Dimethoxypyrimidine Preparation Products And Raw materials |
|
