|  | |  |  | 2-(2-HYDROXYPHENYL)BENZOXAZOLE Basic information | 
|  |  | 2-(2-HYDROXYPHENYL)BENZOXAZOLE Chemical Properties | 
 | Melting point | 122-124 °C(lit.) |  | Boiling point | 338 °C(lit.) |  | density | 1.1868 (rough estimate) |  | refractive index | 6.71E-13 (355 nm) |  | storage temp. | Inert atmosphere,Room Temperature |  | solubility | Solubility Insoluble in water; soluble in ethanol |  | form | Solid |  | pka | 8.04(at 25℃) |  | color | Light yellow to Brown |  | PH Range | Non0 uorescence (<9.3) to blue-violet 0 uorescence (9.3) |  | Major Application | Electroluminescent devices, sensors, plastic scintillation applications, antitumor agent, antibacterial agent |  | InChI | InChI=1S/C13H9NO2/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H |  | InChIKey | GHGZVWOTJDLREY-UHFFFAOYSA-N |  | SMILES | C1(O)=CC=CC=C1C1=NC2=CC=CC=C2O1 |  | CAS DataBase Reference | 835-64-3(CAS DataBase Reference) |  | EPA Substance Registry System | Phenol, 2-(2-benzoxazolyl)- (835-64-3) | 
| Hazard Codes | Xi |  | Risk Statements | 36/37/38 |  | Safety Statements | 26-37/39 |  | WGK Germany | 3 |  | RTECS | SJ7520000 |  | HazardClass | IRRITANT |  | HS Code | 29349990 | 
|  |  | 2-(2-HYDROXYPHENYL)BENZOXAZOLE Usage And Synthesis | 
 | Chemical Properties | pink to reddish crystalline powder |  | Definition | ChEBI: 2-(1,3-benzoxazol-2-yl)phenol is a member of the class of 1,3-benzoxazoles that is 1,3-benzoxazole substituted by a 2-hydroxyphenyl group at position 2. It has a role as a geroprotector. It is a member of phenols and a member of 1,3-benzoxazoles. |  | Purification Methods | Recrystallise it several times from aqueous EtOH or dilute AcOH and sublime it. An aqueous alkaline solution containing EtOH has a blue fluorescence. [Itoh & Fujiwara J Am Chem Soc 107 1561 1985, Beilstein 27 II 91.] | 
|  |  | 2-(2-HYDROXYPHENYL)BENZOXAZOLE Preparation Products And Raw materials | 
 |