|
| | 2,6-Dioxopiperidine-3-ammonium chloride Basic information | | Description |
| Product Name: | 2,6-Dioxopiperidine-3-ammonium chloride | | Synonyms: | 2,6-Dioxopiperidine-3-ammonium chloride;2,6-Dioxopiperidine-3-ammonium;Lenalidomide Impurity 6 HCl;Pomalidomide/lenalidomide INT II;3-Amino-piperidine-2,6-dione [2353-44-8] at 262 USD, please be noted, what we provide is HCl salt form;2,6-dioxopiperidin-3-aminium chloride;Pomalidomide Impurity 6;6-piperidinedione hydrochloride | | CAS: | 24666-56-6 | | MF: | C5H9ClN2O2 | | MW: | 164.59016 | | EINECS: | 807-866-6 | | Product Categories: | Pyrrolidines;24666-56-6 | | Mol File: | 24666-56-6.mol |  |
| | 2,6-Dioxopiperidine-3-ammonium chloride Chemical Properties |
| Melting point | 120 °C (approx) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated), Methanol (Sparingly, Sonicated) | | form | powder | | color | White | | InChI | InChI=1S/C5H8N2O2.ClH/c6-3-1-2-4(8)7-5(3)9;/h3H,1-2,6H2,(H,7,8,9);1H | | InChIKey | YCPULGHBTPQLRH-UHFFFAOYSA-N | | SMILES | C1CC(N)C(=O)NC1=O.Cl |
| | 2,6-Dioxopiperidine-3-ammonium chloride Usage And Synthesis |
| Description | 2,6-Dioxopiperidine-3-ammonium chloride is a reagent for preparing lenalidomide that can induce ubiquitination and degradation of CK1α in del (5q) MDS. It can also be used to prepare phthalimide conjugates that can promote ligand-dependent target protein degradation. Moreover, it is also a metabolite of thalidomide (T338850) that inhibits FGF-induced angiogenesis.
| | Chemical Properties | White crystal | | Uses |
2,6-Dioxopiperidine-3-ammonium chloride can be used as an important intermediate of antineoplastic drug lenalidomide.
|
| | 2,6-Dioxopiperidine-3-ammonium chloride Preparation Products And Raw materials |
|
