|
| | 1,3-Adamantanediol Basic information |
| Product Name: | 1,3-Adamantanediol | | Synonyms: | 1,3-ADAMANTANDIOL;1,3-DIHYDROXYADAMANTANE;ADAMANTANE-1,3-DIOL;AKOS BC-0470;TRICYCLO[3.3.1.13,7]DECANE-1,3-DIOL;1,3-ADAMANTANEDIOL 98+%;1,3-Adamantanediol ,98.50%;1,3-Adamantanediol ,98.5% | | CAS: | 5001-18-3 | | MF: | C10H16O2 | | MW: | 168.23 | | EINECS: | | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Adamantanes;Building Blocks;Chemical Synthesis;Polyols;Pharmaceutical Intermediates;Adamantane derivatives | | Mol File: | 5001-18-3.mol |  |
| | 1,3-Adamantanediol Chemical Properties |
| Melting point | ~260 °C | | Boiling point | 320.4±10.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14?+-.0.40(Predicted) | | color | White to Off-White | | BRN | 7013501 | | InChI | InChI=1S/C10H16O2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8,11-12H,1-6H2 | | InChIKey | MOLCWHCSXCKHAP-UHFFFAOYSA-N | | SMILES | C12(O)CC3CC(CC(O)(C3)C1)C2 | | CAS DataBase Reference | 5001-18-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29061990 |
| | 1,3-Adamantanediol Usage And Synthesis |
| Chemical Properties | white crystal | | Uses |
1,3-Adamantanediol is used in the synthesis of novel dimethacrylate as possible dental monomers for dental resin mixtures.
|
| | 1,3-Adamantanediol Preparation Products And Raw materials |
|
