|
| | Phloroglucinol dihydrate Basic information |
| | Phloroglucinol dihydrate Chemical Properties |
| Melting point | 218-221 °C (A)(lit.) | | Fp | 100 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Sparingly soluble in water, freely soluble in ethanol (96 per cent), practically insoluble in methylene chloride. | | form | Crystalline Powder | | color | Almost white to beige | | Water Solubility | slightly soluble | | Sensitive | Light Sensitive | | Merck | 14,7328 | | BRN | 5109263 | | Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, bases, oxidizing agents. Combustible. | | InChI | InChI=1S/C6H6O3.2H2O/c7-4-1-5(8)3-6(9)2-4;;/h1-3,7-9H;2*1H2 | | InChIKey | MPYXTIHPALVENR-UHFFFAOYSA-N | | SMILES | C1(O)C=C(C=C(O)C=1)O.O.O | | CAS DataBase Reference | 6099-90-7(CAS DataBase Reference) |
| | Phloroglucinol dihydrate Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | In diazo-type printing, textile dyeing. In cosmetics, as antioxidant; hair colorant. As reagent for detection of aldehydes, carbohydrates including lignin, and HCl. Cloud seeding. Rooting medium for woody plants. | | Uses | Phloroglucinol Dihydrate is a reactant used in the synthesis of [2-13C, 4-13C]-(2R,3S)-catechin and [2-13C, 4-13C]-(2R,3R)-epicatechin. | | Purification Methods | Crystallise the triol from water, and store it in the dark under nitrogen. [Beilstein 6 IV 7361.] |
| | Phloroglucinol dihydrate Preparation Products And Raw materials |
|
