|
| | 1,3,5-Tri-tert-butylbenzene Basic information |
| Product Name: | 1,3,5-Tri-tert-butylbenzene | | Synonyms: | 1,3,5-TRI-TERT-BUTYLBENZENE 98+%;1,3,5-TRI-T-BUTYLBENZENE 95%;1,3,5-Tris-tert-butylbenzene;2,4,6-Tri-tert-butylbenzene;1,3,5-Tri-tert-butylbenzene, 97+%;1,3,5-Tri-tert-butylbenzene,95%;1,3,5-Tri-tert-butylbenzene, 95% 2.5GR;1,3,5-Tris-(1,1-dimethylethyl)benzene | | CAS: | 1460-02-2 | | MF: | C18H30 | | MW: | 246.43 | | EINECS: | 215-952-4 | | Product Categories: | Building Blocks;Chemical Synthesis;Arenes;Building Blocks;Organic Building Blocks;Organic Building Blocks | | Mol File: | 1460-02-2.mol |  |
| | 1,3,5-Tri-tert-butylbenzene Chemical Properties |
| Melting point | 67-72 °C (lit.) | | Boiling point | 121-122 °C/12 mmHg (lit.) | | density | 0.8496 (estimate) | | refractive index | 1.4948 (estimate) | | Fp | 121-122°C/12mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Insoluble in water. | | BRN | 1909579 | | InChI | InChI=1S/C18H30/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9/h10-12H,1-9H3 | | InChIKey | GUFMBISUSZUUCB-UHFFFAOYSA-N | | SMILES | C1(C(C)(C)C)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | | CAS DataBase Reference | 1460-02-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,3,5-tri-tert-butyl-(1460-02-2) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29029090 |
| | 1,3,5-Tri-tert-butylbenzene Usage And Synthesis |
| Chemical Properties | WHITE TO ALMOST WHITE CRYSTALLINE SOLID | | Uses | 1,3,5-Tri-tert-butylbenzene is used in the preparation of sandwich complexes of scandium, yttrium and lanthanide ions. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 33, p. 672, 1955 DOI: 10.1139/v55-079 | | General Description | The Sandros-Boltzmann (SB) dependency on the reaction free energy of 1,3,5-tri-tert-butylbenzene has been studied. | | Purification Methods | Crystallise it from EtOH. [Beilstein 5 IV 1206.] |
| | 1,3,5-Tri-tert-butylbenzene Preparation Products And Raw materials |
|